C22H27NO2S — CID 130206328
(2S)-2-(4-butoxyphenyl)-2,5-dimethyl-4-(4-methylthiophen-2-yl)-1,3-dihydropyridin-6-one (PubChem CID 130206328) has the molecular formula C22H27NO2S and a molecular weight of 369.53 g/mol. Its IUPAC name is (2S)-2-(4-butoxyphenyl)-2,5-dimethyl-4-(4-methylthiophen-2-yl)-1,3-dihydropyridin-6-one.
| Compound Name | (2S)-2-(4-butoxyphenyl)-2,5-dimethyl-4-(4-methylthiophen-2-yl)-1,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 130206328 |
| Molecular Formula | C22H27NO2S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (2S)-2-(4-butoxyphenyl)-2,5-dimethyl-4-(4-methylthiophen-2-yl)-1,3-dihydropyridin-6-one |
| SMILES | CCCCOc1ccc([C@]2(C)CC(c3cc(C)cs3)=C(C)C(=O)N2)cc1 |
| InChI | InChI=1S/C22H27NO2S/c1-5-6-11-25-18-9-7-17(8-10-18)22(4)13-19(16(3)21(24)23-22)20-12-15(2)14-26-20/h7-10,12,14H,5-6,11,13H2,1-4H3,(H,23,24)/t22-/m0/s1 |
| InChIKey | VJZOCROTQAUCRU-QFIPXVFZSA-N |
| XLogP | 5.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|