C35H48N4O4 — CID 15528127
methyl 4,11-bis(4-heptylphenyl)-2,6-dioxo-1,3,5,7-tetrazatricyclo[5.3.1.04,11]undecane-9-carboxylate (PubChem CID 15528127) has the molecular formula C35H48N4O4 and a molecular weight of 588.79 g/mol. Its IUPAC name is methyl 4,11-bis(4-heptylphenyl)-2,6-dioxo-1,3,5,7-tetrazatricyclo[5.3.1.04,11]undecane-9-carboxylate.
| Compound Name | methyl 4,11-bis(4-heptylphenyl)-2,6-dioxo-1,3,5,7-tetrazatricyclo[5.3.1.04,11]undecane-9-carboxylate |
|---|---|
| PubChem CID | 15528127 |
| Molecular Formula | C35H48N4O4 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.37 |
| IUPAC Name | methyl 4,11-bis(4-heptylphenyl)-2,6-dioxo-1,3,5,7-tetrazatricyclo[5.3.1.04,11]undecane-9-carboxylate |
| SMILES | CCCCCCCc1ccc(C23NC(=O)N4CC(C(=O)OC)CN(C(=O)N2)C43c2ccc(CCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C35H48N4O4/c1-4-6-8-10-12-14-26-16-20-29(21-17-26)34-35(30-22-18-27(19-23-30)15-13-11-9-7-5-2)38(32(41)36-34)24-28(31(40)43-3)25-39(35)33(42)37-34/h16-23,28H,4-15,24-25H2,1-3H3,(H,36,41)(H,37,42) |
| InChIKey | ASSMEYBGBNQOAW-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|