C34H46N4O2 — CID 15528126
4,11-bis(4-heptylphenyl)-9-methylidene-1,3,5,7-tetrazatricyclo[5.3.1.04,11]undecane-2,6-dione (PubChem CID 15528126) has the molecular formula C34H46N4O2 and a molecular weight of 542.77 g/mol. Its IUPAC name is 4,11-bis(4-heptylphenyl)-9-methylidene-1,3,5,7-tetrazatricyclo[5.3.1.04,11]undecane-2,6-dione.
| Compound Name | 4,11-bis(4-heptylphenyl)-9-methylidene-1,3,5,7-tetrazatricyclo[5.3.1.04,11]undecane-2,6-dione |
|---|---|
| PubChem CID | 15528126 |
| Molecular Formula | C34H46N4O2 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.36 |
| IUPAC Name | 4,11-bis(4-heptylphenyl)-9-methylidene-1,3,5,7-tetrazatricyclo[5.3.1.04,11]undecane-2,6-dione |
| SMILES | C=C1CN2C(=O)NC3(c4ccc(CCCCCCC)cc4)NC(=O)N(C1)C23c1ccc(CCCCCCC)cc1 |
| InChI | InChI=1S/C34H46N4O2/c1-4-6-8-10-12-14-27-16-20-29(21-17-27)33-34(30-22-18-28(19-23-30)15-13-11-9-7-5-2)37(31(39)35-33)24-26(3)25-38(34)32(40)36-33/h16-23H,3-15,24-25H2,1-2H3,(H,35,39)(H,36,40) |
| InChIKey | GWCNXFBELKQORA-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|