C45H57N3 — CID 131973940
4-[4-(4-tert-butylphenyl)-2-ethylphenyl]-3-[3-(4-tert-butylphenyl)phenyl]-5-(2-methyloctan-2-yl)-1,2,4-triazole (PubChem CID 131973940) has the molecular formula C45H57N3 and a molecular weight of 639.97 g/mol. Its IUPAC name is 4-[4-(4-tert-butylphenyl)-2-ethylphenyl]-3-[3-(4-tert-butylphenyl)phenyl]-5-(2-methyloctan-2-yl)-1,2,4-triazole.
| Compound Name | 4-[4-(4-tert-butylphenyl)-2-ethylphenyl]-3-[3-(4-tert-butylphenyl)phenyl]-5-(2-methyloctan-2-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 131973940 |
| Molecular Formula | C45H57N3 |
| Molecular Weight | 639.97 g/mol |
| Exact Mass | 639.46 |
| IUPAC Name | 4-[4-(4-tert-butylphenyl)-2-ethylphenyl]-3-[3-(4-tert-butylphenyl)phenyl]-5-(2-methyloctan-2-yl)-1,2,4-triazole |
| SMILES | CCCCCCC(C)(C)c1nnc(-c2cccc(-c3ccc(C(C)(C)C)cc3)c2)n1-c1ccc(-c2ccc(C(C)(C)C)cc2)cc1CC |
| InChI | InChI=1S/C45H57N3/c1-11-13-14-15-29-45(9,10)42-47-46-41(37-18-16-17-35(31-37)33-19-24-38(25-20-33)43(3,4)5)48(42)40-28-23-36(30-32(40)12-2)34-21-26-39(27-22-34)44(6,7)8/h16-28,30-31H,11-15,29H2,1-10H3 |
| InChIKey | FIRMMRWHYDYZMZ-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.97 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|