C29H41N3 — CID 131974021
4-(2-hexylphenyl)-3-(2-methylpentan-2-yl)-5-(3-propan-2-ylphenyl)-1,2,4-triazole (PubChem CID 131974021) has the molecular formula C29H41N3 and a molecular weight of 431.67 g/mol. Its IUPAC name is 4-(2-hexylphenyl)-3-(2-methylpentan-2-yl)-5-(3-propan-2-ylphenyl)-1,2,4-triazole.
| Compound Name | 4-(2-hexylphenyl)-3-(2-methylpentan-2-yl)-5-(3-propan-2-ylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 131974021 |
| Molecular Formula | C29H41N3 |
| Molecular Weight | 431.67 g/mol |
| Exact Mass | 431.33 |
| IUPAC Name | 4-(2-hexylphenyl)-3-(2-methylpentan-2-yl)-5-(3-propan-2-ylphenyl)-1,2,4-triazole |
| SMILES | CCCCCCc1ccccc1-n1c(-c2cccc(C(C)C)c2)nnc1C(C)(C)CCC |
| InChI | InChI=1S/C29H41N3/c1-7-9-10-11-15-23-16-12-13-19-26(23)32-27(25-18-14-17-24(21-25)22(3)4)30-31-28(32)29(5,6)20-8-2/h12-14,16-19,21-22H,7-11,15,20H2,1-6H3 |
| InChIKey | DGXJNERWDUBHME-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.67 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|