C10H9N3O3 — CID 131974169
5-(furan-2-ylmethylamino)pyrimidine-4-carboxylic acid (PubChem CID 131974169) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 5-(furan-2-ylmethylamino)pyrimidine-4-carboxylic acid.
| Compound Name | 5-(furan-2-ylmethylamino)pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 131974169 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 5-(furan-2-ylmethylamino)pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1ncncc1NCc1ccco1 |
| InChI | InChI=1S/C10H9N3O3/c14-10(15)9-8(5-11-6-13-9)12-4-7-2-1-3-16-7/h1-3,5-6,12H,4H2,(H,14,15) |
| InChIKey | GYLVTUPUMLKOKA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |