C19H12N2O3S — CID 131974287
8-(1-benzothiophene-2-carbonylamino)quinoline-2-carboxylic acid (PubChem CID 131974287) has the molecular formula C19H12N2O3S and a molecular weight of 348.38 g/mol. Its IUPAC name is 8-(1-benzothiophene-2-carbonylamino)quinoline-2-carboxylic acid.
| Compound Name | 8-(1-benzothiophene-2-carbonylamino)quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 131974287 |
| Molecular Formula | C19H12N2O3S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 8-(1-benzothiophene-2-carbonylamino)quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2cccc(NC(=O)c3cc4ccccc4s3)c2n1 |
| InChI | InChI=1S/C19H12N2O3S/c22-18(16-10-12-4-1-2-7-15(12)25-16)21-13-6-3-5-11-8-9-14(19(23)24)20-17(11)13/h1-10H,(H,21,22)(H,23,24) |
| InChIKey | ZNLFBUAMEVMEHP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |