About N-[2-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-3-yl]acetamide
N-[2-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-3-yl]acetamide (PubChem CID 131974418) has the molecular formula C14H18N2O5
and a molecular weight of 294.31 g/mol. Its IUPAC name is N-[2-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[2-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-3-yl]acetamide |
| PubChem CID | 131974418 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-[2-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-3-yl]acetamide |
| SMILES | COc1cc(N2CC(NC(C)=O)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C14H18N2O5/c1-8(17)15-10-7-16(14(10)18)9-5-11(19-2)13(21-4)12(6-9)20-3/h5-6,10H,7H2,1-4H3,(H,15,17) |
| InChIKey | NJVGYLBBVQUKKX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-3-yl]acetamide?
The IUPAC name of N-[2-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-3-yl]acetamide (CID 131974418) is N-[2-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-3-yl]acetamide.
What is the SMILES notation for N-[2-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-3-yl]acetamide?
The canonical SMILES for N-[2-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-3-yl]acetamide is COc1cc(N2CC(NC(C)=O)C2=O)cc(OC)c1OC.
What is the InChIKey of N-[2-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-3-yl]acetamide?
The InChIKey is NJVGYLBBVQUKKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O5/c1-8(17)15-10-7-16(14(10)18)9-5-11(19-2)13(21-4)12(6-9)20-3/h5-6,10H,7H2,1-4H3,(H,15,17).
What are the key properties of N-[2-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-3-yl]acetamide?
N-[2-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-3-yl]acetamide has a molecular weight of 294.31 g/mol, XLogP of 0.56, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-3-yl]acetamide is sourced from PubChem (CID 131974418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).