C15H16N2O7 — CID 3277901
5-acetyl-1-(3,4,5-trimethoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 3277901) has the molecular formula C15H16N2O7 and a molecular weight of 336.30 g/mol. Its IUPAC name is 5-acetyl-1-(3,4,5-trimethoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-acetyl-1-(3,4,5-trimethoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3277901 |
| Molecular Formula | C15H16N2O7 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 5-acetyl-1-(3,4,5-trimethoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(N2C(=O)NC(=O)C(C(C)=O)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C15H16N2O7/c1-7(18)11-13(19)16-15(21)17(14(11)20)8-5-9(22-2)12(24-4)10(6-8)23-3/h5-6,11H,1-4H3,(H,16,19,21) |
| InChIKey | JLZYCIXGOBWGDV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|