C3H4NO5S- — CID 131975255
1-hydroxy-1,3-dioxo-3-(sulfinatoamino)propane (PubChem CID 131975255) has the molecular formula C3H4NO5S- and a molecular weight of 166.13 g/mol. Its IUPAC name is 1-hydroxy-1,3-dioxo-3-(sulfinatoamino)propane.
| Compound Name | 1-hydroxy-1,3-dioxo-3-(sulfinatoamino)propane |
|---|---|
| PubChem CID | 131975255 |
| Molecular Formula | C3H4NO5S- |
| Molecular Weight | 166.13 g/mol |
| Exact Mass | 165.98 |
| IUPAC Name | 1-hydroxy-1,3-dioxo-3-(sulfinatoamino)propane |
| SMILES | O=C(O)CC(=O)NS(=O)[O-] |
| InChI | InChI=1S/C3H5NO5S/c5-2(1-3(6)7)4-10(8)9/h1H2,(H,4,5)(H,6,7)(H,8,9)/p-1 |
| InChIKey | RYYNMJGCPZGYQX-UHFFFAOYSA-M |
| XLogP | -1.63 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.13 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|