C43H42N2O8 — CID 131976763
N-[(2,4-dimethylphenyl)methyl]-2,3,5-trihydroxy-7-methyl-6-[1,6,7-trihydroxy-3-methyl-5-[(2,4,6-trimethylphenyl)methylcarbamoyl]naphthalen-2-yl]naphthalene-1-carboxamide (PubChem CID 131976763) has the molecular formula C43H42N2O8 and a molecular weight of 714.82 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-2,3,5-trihydroxy-7-methyl-6-[1,6,7-trihydroxy-3-methyl-5-[(2,4,6-trimethylphenyl)methylcarbamoyl]naphthalen-2-yl]naphthalene-1-carboxamide.
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-2,3,5-trihydroxy-7-methyl-6-[1,6,7-trihydroxy-3-methyl-5-[(2,4,6-trimethylphenyl)methylcarbamoyl]naphthalen-2-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 131976763 |
| Molecular Formula | C43H42N2O8 |
| Molecular Weight | 714.82 g/mol |
| Exact Mass | 714.29 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-2,3,5-trihydroxy-7-methyl-6-[1,6,7-trihydroxy-3-methyl-5-[(2,4,6-trimethylphenyl)methylcarbamoyl]naphthalen-2-yl]naphthalene-1-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2c(O)c(O)cc3c(O)c(-c4c(C)cc5c(C(=O)NCc6c(C)cc(C)cc6C)c(O)c(O)cc5c4O)c(C)cc23)c(C)c1 |
| InChI | InChI=1S/C43H42N2O8/c1-19-8-9-26(21(3)10-19)17-44-42(52)36-27-13-24(6)34(38(48)29(27)15-32(46)40(36)50)35-25(7)14-28-30(39(35)49)16-33(47)41(51)37(28)43(53)45-18-31-22(4)11-20(2)12-23(31)5/h8-16,46-51H,17-18H2,1-7H3,(H,44,52)(H,45,53) |
| InChIKey | IPKIHINNGFGKSR-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 179.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.82 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|