C41H38N2O7 — CID 59544859
6-[1,6-dihydroxy-3,7-dimethyl-5-(1-phenylethylcarbamoyl)naphthalen-2-yl]-2,3,5-trihydroxy-7-methyl-N-(1-phenylethyl)naphthalene-1-carboxamide (PubChem CID 59544859) has the molecular formula C41H38N2O7 and a molecular weight of 670.76 g/mol. Its IUPAC name is 6-[1,6-dihydroxy-3,7-dimethyl-5-(1-phenylethylcarbamoyl)naphthalen-2-yl]-2,3,5-trihydroxy-7-methyl-N-(1-phenylethyl)naphthalene-1-carboxamide.
| Compound Name | 6-[1,6-dihydroxy-3,7-dimethyl-5-(1-phenylethylcarbamoyl)naphthalen-2-yl]-2,3,5-trihydroxy-7-methyl-N-(1-phenylethyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 59544859 |
| Molecular Formula | C41H38N2O7 |
| Molecular Weight | 670.76 g/mol |
| Exact Mass | 670.27 |
| IUPAC Name | 6-[1,6-dihydroxy-3,7-dimethyl-5-(1-phenylethylcarbamoyl)naphthalen-2-yl]-2,3,5-trihydroxy-7-methyl-N-(1-phenylethyl)naphthalene-1-carboxamide |
| SMILES | Cc1cc2c(O)c(-c3c(C)cc4c(C(=O)NC(C)c5ccccc5)c(O)c(O)cc4c3O)c(C)cc2c(C(=O)NC(C)c2ccccc2)c1O |
| InChI | InChI=1S/C41H38N2O7/c1-20-16-27-29(18-22(3)36(45)34(27)40(49)42-23(4)25-12-8-6-9-13-25)37(46)32(20)33-21(2)17-28-30(38(33)47)19-31(44)39(48)35(28)41(50)43-24(5)26-14-10-7-11-15-26/h6-19,23-24,44-48H,1-5H3,(H,42,49)(H,43,50) |
| InChIKey | FWRZWVNZFJSNEK-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.76 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|