C18H15F3N2 — CID 131981605
4-[2-(4-ethylphenyl)ethynyl]-3-(trifluoromethyl)benzenecarboximidamide (PubChem CID 131981605) has the molecular formula C18H15F3N2 and a molecular weight of 316.33 g/mol. Its IUPAC name is 4-[2-(4-ethylphenyl)ethynyl]-3-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 4-[2-(4-ethylphenyl)ethynyl]-3-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 131981605 |
| Molecular Formula | C18H15F3N2 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4-[2-(4-ethylphenyl)ethynyl]-3-(trifluoromethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C#Cc2ccc(CC)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F3N2/c1-2-12-3-5-13(6-4-12)7-8-14-9-10-15(17(22)23)11-16(14)18(19,20)21/h3-6,9-11H,2H2,1H3,(H3,22,23) |
| InChIKey | LTKCOVYXLNLLNS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|