C15H27F3O2 — CID 131982827
methyl (2S,9S)-2,10-dimethyl-9-(trifluoromethyl)undecanoate (PubChem CID 131982827) has the molecular formula C15H27F3O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is methyl (2S,9S)-2,10-dimethyl-9-(trifluoromethyl)undecanoate.
| Compound Name | methyl (2S,9S)-2,10-dimethyl-9-(trifluoromethyl)undecanoate |
|---|---|
| PubChem CID | 131982827 |
| Molecular Formula | C15H27F3O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | methyl (2S,9S)-2,10-dimethyl-9-(trifluoromethyl)undecanoate |
| SMILES | COC(=O)[C@@H](C)CCCCCC[C@@H](C(C)C)C(F)(F)F |
| InChI | InChI=1S/C15H27F3O2/c1-11(2)13(15(16,17)18)10-8-6-5-7-9-12(3)14(19)20-4/h11-13H,5-10H2,1-4H3/t12-,13-/m0/s1 |
| InChIKey | VOYIWUVXKRAXNE-STQMWFEESA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|