methyl 4-methyl-3-(trifluoromethyl)pentanoate

C8H13F3O2 — CID 59459020

IUPACmethyl 4-methyl-3-(trifluoromethyl)pentanoate
SMILESCOC(=O)CC(C(C)C)C(F)(F)F
InChIInChI=1S/C8H13F3O2/c1-5(2)6(8(9,10)11)4-7(12)13-3/h5-6H,4H2,1-3H3
InChIKeyPEAWBTWIIFYSQX-UHFFFAOYSA-N
MW198.18 g/mol
LogP2.38
Rot. Bonds3

About methyl 4-methyl-3-(trifluoromethyl)pentanoate

methyl 4-methyl-3-(trifluoromethyl)pentanoate (PubChem CID 59459020) has the molecular formula C8H13F3O2 and a molecular weight of 198.18 g/mol. Its IUPAC name is methyl 4-methyl-3-(trifluoromethyl)pentanoate.

Molecular Properties

Compound Namemethyl 4-methyl-3-(trifluoromethyl)pentanoate
PubChem CID59459020
Molecular FormulaC8H13F3O2
Molecular Weight198.18 g/mol
Exact Mass198.09
IUPAC Namemethyl 4-methyl-3-(trifluoromethyl)pentanoate
SMILESCOC(=O)CC(C(C)C)C(F)(F)F
InChIInChI=1S/C8H13F3O2/c1-5(2)6(8(9,10)11)4-7(12)13-3/h5-6H,4H2,1-3H3
InChIKeyPEAWBTWIIFYSQX-UHFFFAOYSA-N
XLogP2.38
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.18
LogP ≤ 52.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 4-methyl-3-(trifluoromethyl)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-methyl-3-(trifluoromethyl)pentanoate?
The IUPAC name of methyl 4-methyl-3-(trifluoromethyl)pentanoate (CID 59459020) is methyl 4-methyl-3-(trifluoromethyl)pentanoate.
What is the SMILES notation for methyl 4-methyl-3-(trifluoromethyl)pentanoate?
The canonical SMILES for methyl 4-methyl-3-(trifluoromethyl)pentanoate is COC(=O)CC(C(C)C)C(F)(F)F.
What is the InChIKey of methyl 4-methyl-3-(trifluoromethyl)pentanoate?
The InChIKey is PEAWBTWIIFYSQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3O2/c1-5(2)6(8(9,10)11)4-7(12)13-3/h5-6H,4H2,1-3H3.
What are the key properties of methyl 4-methyl-3-(trifluoromethyl)pentanoate?
methyl 4-methyl-3-(trifluoromethyl)pentanoate has a molecular weight of 198.18 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methyl-3-(trifluoromethyl)pentanoate is sourced from PubChem (CID 59459020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).