C9H17F3IN — CID 131982830
(2S)-2-iodo-2-methyl-N-(2,2,2-trifluoroethyl)hexan-1-amine (PubChem CID 131982830) has the molecular formula C9H17F3IN and a molecular weight of 323.14 g/mol. Its IUPAC name is (2S)-2-iodo-2-methyl-N-(2,2,2-trifluoroethyl)hexan-1-amine.
| Compound Name | (2S)-2-iodo-2-methyl-N-(2,2,2-trifluoroethyl)hexan-1-amine |
|---|---|
| PubChem CID | 131982830 |
| Molecular Formula | C9H17F3IN |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | (2S)-2-iodo-2-methyl-N-(2,2,2-trifluoroethyl)hexan-1-amine |
| SMILES | CCCC[C@](C)(I)CNCC(F)(F)F |
| InChI | InChI=1S/C9H17F3IN/c1-3-4-5-8(2,13)6-14-7-9(10,11)12/h14H,3-7H2,1-2H3/t8-/m0/s1 |
| InChIKey | NJOVOJKSHBXHKQ-QMMMGPOBSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|