C12H9N3O3S — CID 131984041
4-azido-3,4-dihydro-2H-thieno[3,2-g]chromene-7-carboxylic acid (PubChem CID 131984041) has the molecular formula C12H9N3O3S and a molecular weight of 275.29 g/mol. Its IUPAC name is 4-azido-3,4-dihydro-2H-thieno[3,2-g]chromene-7-carboxylic acid.
| Compound Name | 4-azido-3,4-dihydro-2H-thieno[3,2-g]chromene-7-carboxylic acid |
|---|---|
| PubChem CID | 131984041 |
| Molecular Formula | C12H9N3O3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 4-azido-3,4-dihydro-2H-thieno[3,2-g]chromene-7-carboxylic acid |
| SMILES | [N-]=[N+]=NC1CCOc2cc3sc(C(=O)O)cc3cc21 |
| InChI | InChI=1S/C12H9N3O3S/c13-15-14-8-1-2-18-9-5-10-6(3-7(8)9)4-11(19-10)12(16)17/h3-5,8H,1-2H2,(H,16,17) |
| InChIKey | MPNNUHOUJRFIAL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|