C25H28ClN3O — CID 131985638
N-[1-[(5-chloro-2-pyridinyl)amino]-4-methylpentan-2-yl]-N-methyl-2-phenylbenzamide (PubChem CID 131985638) has the molecular formula C25H28ClN3O and a molecular weight of 421.97 g/mol. Its IUPAC name is N-[1-[(5-chloro-2-pyridinyl)amino]-4-methylpentan-2-yl]-N-methyl-2-phenylbenzamide.
| Compound Name | N-[1-[(5-chloro-2-pyridinyl)amino]-4-methylpentan-2-yl]-N-methyl-2-phenylbenzamide |
|---|---|
| PubChem CID | 131985638 |
| Molecular Formula | C25H28ClN3O |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N-[1-[(5-chloro-2-pyridinyl)amino]-4-methylpentan-2-yl]-N-methyl-2-phenylbenzamide |
| SMILES | CC(C)CC(CNc1ccc(Cl)cn1)N(C)C(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H28ClN3O/c1-18(2)15-21(17-28-24-14-13-20(26)16-27-24)29(3)25(30)23-12-8-7-11-22(23)19-9-5-4-6-10-19/h4-14,16,18,21H,15,17H2,1-3H3,(H,27,28) |
| InChIKey | SYDILIAXENJZGT-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |