C25H27ClN2O — CID 160860689
N-[(3R)-1-(5-chloro-2-pyridinyl)-5-methylhexan-3-yl]-2-phenylbenzamide (PubChem CID 160860689) has the molecular formula C25H27ClN2O and a molecular weight of 406.96 g/mol. Its IUPAC name is N-[(3R)-1-(5-chloro-2-pyridinyl)-5-methylhexan-3-yl]-2-phenylbenzamide.
| Compound Name | N-[(3R)-1-(5-chloro-2-pyridinyl)-5-methylhexan-3-yl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 160860689 |
| Molecular Formula | C25H27ClN2O |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-[(3R)-1-(5-chloro-2-pyridinyl)-5-methylhexan-3-yl]-2-phenylbenzamide |
| SMILES | CC(C)C[C@@H](CCc1ccc(Cl)cn1)NC(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H27ClN2O/c1-18(2)16-22(15-14-21-13-12-20(26)17-27-21)28-25(29)24-11-7-6-10-23(24)19-8-4-3-5-9-19/h3-13,17-18,22H,14-16H2,1-2H3,(H,28,29)/t22-/m1/s1 |
| InChIKey | SKLCVWHFBMGGEL-JOCHJYFZSA-N |
| XLogP | 6.18 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |