C22H21ClN2O — CID 160508133
N-[3-(5-chloro-2-pyridinyl)propyl]-N-methyl-2-phenylbenzamide (PubChem CID 160508133) has the molecular formula C22H21ClN2O and a molecular weight of 364.88 g/mol. Its IUPAC name is N-[3-(5-chloro-2-pyridinyl)propyl]-N-methyl-2-phenylbenzamide.
| Compound Name | N-[3-(5-chloro-2-pyridinyl)propyl]-N-methyl-2-phenylbenzamide |
|---|---|
| PubChem CID | 160508133 |
| Molecular Formula | C22H21ClN2O |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | N-[3-(5-chloro-2-pyridinyl)propyl]-N-methyl-2-phenylbenzamide |
| SMILES | CN(CCCc1ccc(Cl)cn1)C(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H21ClN2O/c1-25(15-7-10-19-14-13-18(23)16-24-19)22(26)21-12-6-5-11-20(21)17-8-3-2-4-9-17/h2-6,8-9,11-14,16H,7,10,15H2,1H3 |
| InChIKey | QSRMARNVRNQQCS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |