C18H24N7O2S+ — CID 131986491
[4-[6-[(5-carboxy-1,3-thiazol-2-yl)amino]-2-methylpyrimidin-4-yl]piperazin-1-yl]-cyclopropyl-ethylideneazanium (PubChem CID 131986491) has the molecular formula C18H24N7O2S+ and a molecular weight of 402.50 g/mol. Its IUPAC name is [4-[6-[(5-carboxy-1,3-thiazol-2-yl)amino]-2-methylpyrimidin-4-yl]piperazin-1-yl]-cyclopropyl-ethylideneazanium.
| Compound Name | [4-[6-[(5-carboxy-1,3-thiazol-2-yl)amino]-2-methylpyrimidin-4-yl]piperazin-1-yl]-cyclopropyl-ethylideneazanium |
|---|---|
| PubChem CID | 131986491 |
| Molecular Formula | C18H24N7O2S+ |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [4-[6-[(5-carboxy-1,3-thiazol-2-yl)amino]-2-methylpyrimidin-4-yl]piperazin-1-yl]-cyclopropyl-ethylideneazanium |
| SMILES | CC=[N+](C1CC1)N1CCN(c2cc(Nc3ncc(C(=O)O)s3)nc(C)n2)CC1 |
| InChI | InChI=1S/C18H23N7O2S/c1-3-25(13-4-5-13)24-8-6-23(7-9-24)16-10-15(20-12(2)21-16)22-18-19-11-14(28-18)17(26)27/h3,10-11,13H,4-9H2,1-2H3,(H-,19,20,21,22,26,27)/p+1 |
| InChIKey | QANGSFRPKGCPTC-UHFFFAOYSA-O |
| XLogP | 1.99 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|