C23H28N6O3S — CID 89258369
methyl 2-[[2-methyl-6-[4-(2-phenylmethoxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 89258369) has the molecular formula C23H28N6O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is methyl 2-[[2-methyl-6-[4-(2-phenylmethoxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[[2-methyl-6-[4-(2-phenylmethoxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 89258369 |
| Molecular Formula | C23H28N6O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | methyl 2-[[2-methyl-6-[4-(2-phenylmethoxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(Nc2cc(N3CCN(CCOCc4ccccc4)CC3)nc(C)n2)s1 |
| InChI | InChI=1S/C23H28N6O3S/c1-17-25-20(27-23-24-15-19(33-23)22(30)31-2)14-21(26-17)29-10-8-28(9-11-29)12-13-32-16-18-6-4-3-5-7-18/h3-7,14-15H,8-13,16H2,1-2H3,(H,24,25,26,27) |
| InChIKey | UJVFDFXHEXHUQQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|