C20H30N6O4S — CID 174599787
2-[2-[[6-[4-[2-(1-ethoxyethoxy)ethyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazol-5-yl]acetic acid (PubChem CID 174599787) has the molecular formula C20H30N6O4S and a molecular weight of 450.57 g/mol. Its IUPAC name is 2-[2-[[6-[4-[2-(1-ethoxyethoxy)ethyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[2-[[6-[4-[2-(1-ethoxyethoxy)ethyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 174599787 |
| Molecular Formula | C20H30N6O4S |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 2-[2-[[6-[4-[2-(1-ethoxyethoxy)ethyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazol-5-yl]acetic acid |
| SMILES | CCOC(C)OCCN1CCN(c2cc(Nc3ncc(CC(=O)O)s3)nc(C)n2)CC1 |
| InChI | InChI=1S/C20H30N6O4S/c1-4-29-15(3)30-10-9-25-5-7-26(8-6-25)18-12-17(22-14(2)23-18)24-20-21-13-16(31-20)11-19(27)28/h12-13,15H,4-11H2,1-3H3,(H,27,28)(H,21,22,23,24) |
| InChIKey | BGSHZLKQOJZYGW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|