C25H32N6O3S — CID 89258364
propan-2-yl 2-[[2-methyl-6-[4-(2-phenylmethoxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 89258364) has the molecular formula C25H32N6O3S and a molecular weight of 496.64 g/mol. Its IUPAC name is propan-2-yl 2-[[2-methyl-6-[4-(2-phenylmethoxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | propan-2-yl 2-[[2-methyl-6-[4-(2-phenylmethoxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 89258364 |
| Molecular Formula | C25H32N6O3S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | propan-2-yl 2-[[2-methyl-6-[4-(2-phenylmethoxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(Nc2ncc(C(=O)OC(C)C)s2)cc(N2CCN(CCOCc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C25H32N6O3S/c1-18(2)34-24(32)21-16-26-25(35-21)29-22-15-23(28-19(3)27-22)31-11-9-30(10-12-31)13-14-33-17-20-7-5-4-6-8-20/h4-8,15-16,18H,9-14,17H2,1-3H3,(H,26,27,28,29) |
| InChIKey | JVICLHLWYHOIDV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|