C18H27N9O4S — CID 131986492
2-[[4-hydrazinyl-6-[4-[2-(oxan-2-yloxy)ethyl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-1,3-thiazole-5-carboxylic acid (PubChem CID 131986492) has the molecular formula C18H27N9O4S and a molecular weight of 465.54 g/mol. Its IUPAC name is 2-[[4-hydrazinyl-6-[4-[2-(oxan-2-yloxy)ethyl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[[4-hydrazinyl-6-[4-[2-(oxan-2-yloxy)ethyl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 131986492 |
| Molecular Formula | C18H27N9O4S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 2-[[4-hydrazinyl-6-[4-[2-(oxan-2-yloxy)ethyl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-1,3-thiazole-5-carboxylic acid |
| SMILES | NNc1nc(Nc2ncc(C(=O)O)s2)nc(N2CCN(CCOC3CCCCO3)CC2)n1 |
| InChI | InChI=1S/C18H27N9O4S/c19-25-16-21-15(24-18-20-11-12(32-18)14(28)29)22-17(23-16)27-6-4-26(5-7-27)8-10-31-13-3-1-2-9-30-13/h11,13H,1-10,19H2,(H,28,29)(H2,20,21,22,23,24,25) |
| InChIKey | MBQSYDZQPLHGCO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 163.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|