C12H16N2 — CID 131990448
N-[(1E)-2-(2,3,4,5-tetrahydropyridin-6-yl)buta-1,3-dienyl]prop-2-en-1-imine (PubChem CID 131990448) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N-[(1E)-2-(2,3,4,5-tetrahydropyridin-6-yl)buta-1,3-dienyl]prop-2-en-1-imine.
| Compound Name | N-[(1E)-2-(2,3,4,5-tetrahydropyridin-6-yl)buta-1,3-dienyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 131990448 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N-[(1E)-2-(2,3,4,5-tetrahydropyridin-6-yl)buta-1,3-dienyl]prop-2-en-1-imine |
| SMILES | C=C/C=N/C=C(\C=C)C1=NCCCC1 |
| InChI | InChI=1S/C12H16N2/c1-3-8-13-10-11(4-2)12-7-5-6-9-14-12/h3-4,8,10H,1-2,5-7,9H2/b11-10+,13-8+ |
| InChIKey | DPUKGIVSIXUFOL-OGFJCPFKSA-N |
| XLogP | 2.94 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|