C22H20F3N5O2 — CID 131991957
1-methylidene-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopentyl]urea (PubChem CID 131991957) has the molecular formula C22H20F3N5O2 and a molecular weight of 443.43 g/mol. Its IUPAC name is 1-methylidene-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopentyl]urea.
| Compound Name | 1-methylidene-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopentyl]urea |
|---|---|
| PubChem CID | 131991957 |
| Molecular Formula | C22H20F3N5O2 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 1-methylidene-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]cyclopentyl]urea |
| SMILES | C=NC(=O)NC1CCC(c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)C1 |
| InChI | InChI=1S/C22H20F3N5O2/c1-26-21(31)28-17-7-6-16(12-17)14-2-4-15(5-3-14)20-27-13-30(29-20)18-8-10-19(11-9-18)32-22(23,24)25/h2-5,8-11,13,16-17H,1,6-7,12H2,(H,28,31) |
| InChIKey | LODSKCYDICMTGU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|