C17H30N8O3 — CID 131994626
(2E,4E)-2-[1-[2-(diaminomethylideneamino)ethoxy]ethenyl]-4-[5-(diaminomethylideneamino)pentanoylamino]hexa-2,4-dienamide (PubChem CID 131994626) has the molecular formula C17H30N8O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is (2E,4E)-2-[1-[2-(diaminomethylideneamino)ethoxy]ethenyl]-4-[5-(diaminomethylideneamino)pentanoylamino]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-2-[1-[2-(diaminomethylideneamino)ethoxy]ethenyl]-4-[5-(diaminomethylideneamino)pentanoylamino]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 131994626 |
| Molecular Formula | C17H30N8O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (2E,4E)-2-[1-[2-(diaminomethylideneamino)ethoxy]ethenyl]-4-[5-(diaminomethylideneamino)pentanoylamino]hexa-2,4-dienamide |
| SMILES | C=C(OCCN=C(N)N)/C(=C\C(=C/C)NC(=O)CCCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C17H30N8O3/c1-3-12(25-14(26)6-4-5-7-23-16(19)20)10-13(15(18)27)11(2)28-9-8-24-17(21)22/h3,10H,2,4-9H2,1H3,(H2,18,27)(H,25,26)(H4,19,20,23)(H4,21,22,24)/b12-3+,13-10+ |
| InChIKey | CIBHZZDXDLDVRX-HZEGRFMRSA-N |
| XLogP | -1.33 |
| TPSA | 210.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|