C21H29NO2 — CID 131997301
(2E,4Z,6Z)-6-[1-(3-methoxyphenyl)ethyl]-N,2,4-trimethylnona-2,4,6-trienamide (PubChem CID 131997301) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (2E,4Z,6Z)-6-[1-(3-methoxyphenyl)ethyl]-N,2,4-trimethylnona-2,4,6-trienamide.
| Compound Name | (2E,4Z,6Z)-6-[1-(3-methoxyphenyl)ethyl]-N,2,4-trimethylnona-2,4,6-trienamide |
|---|---|
| PubChem CID | 131997301 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (2E,4Z,6Z)-6-[1-(3-methoxyphenyl)ethyl]-N,2,4-trimethylnona-2,4,6-trienamide |
| SMILES | CC/C=C(/C=C(C)\C=C(/C)C(=O)NC)C(C)c1cccc(OC)c1 |
| InChI | InChI=1S/C21H29NO2/c1-7-9-18(13-15(2)12-16(3)21(23)22-5)17(4)19-10-8-11-20(14-19)24-6/h8-14,17H,7H2,1-6H3,(H,22,23)/b15-13-,16-12+,18-9- |
| InChIKey | SNWQUINXERQBKO-NRWCWGEBSA-N |
| XLogP | 4.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|