About [1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene
[1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene (PubChem CID 13204041) has the molecular formula C17H16OS2
and a molecular weight of 300.45 g/mol. Its IUPAC name is [1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene.
Molecular Properties
| Compound Name | [1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene |
| PubChem CID | 13204041 |
| Molecular Formula | C17H16OS2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | [1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene |
| SMILES | CC(C)=C=C(Sc1ccccc1)S(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16OS2/c1-14(2)13-17(19-15-9-5-3-6-10-15)20(18)16-11-7-4-8-12-16/h3-12H,1-2H3 |
| InChIKey | JUKSBAJCCVDTCN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene?
The IUPAC name of [1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene (CID 13204041) is [1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene.
What is the SMILES notation for [1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene?
The canonical SMILES for [1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene is CC(C)=C=C(Sc1ccccc1)S(=O)c1ccccc1.
What is the InChIKey of [1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene?
The InChIKey is JUKSBAJCCVDTCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16OS2/c1-14(2)13-17(19-15-9-5-3-6-10-15)20(18)16-11-7-4-8-12-16/h3-12H,1-2H3.
What are the key properties of [1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene?
[1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene has a molecular weight of 300.45 g/mol, XLogP of 4.99, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(benzenesulfinyl)-3-methylbuta-1,2-dienyl]sulfanylbenzene is sourced from PubChem (CID 13204041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).