About 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane
4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane (PubChem CID 13210) has the molecular formula C6H11O3P
and a molecular weight of 162.12 g/mol. Its IUPAC name is 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane |
| PubChem CID | 13210 |
| Molecular Formula | C6H11O3P |
| Molecular Weight | 162.12 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane |
| SMILES | CCC12COP(OC1)OC2 |
| InChI | InChI=1S/C6H11O3P/c1-2-6-3-7-10(8-4-6)9-5-6/h2-5H2,1H3 |
| InChIKey | QRUSNTDXJQBKBI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.12 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane?
The IUPAC name of 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane (CID 13210) is 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane.
What is the SMILES notation for 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane?
The canonical SMILES for 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane is CCC12COP(OC1)OC2.
What is the InChIKey of 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane?
The InChIKey is QRUSNTDXJQBKBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11O3P/c1-2-6-3-7-10(8-4-6)9-5-6/h2-5H2,1H3.
What are the key properties of 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane?
4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane has a molecular weight of 162.12 g/mol, XLogP of 1.69, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane is sourced from PubChem (CID 13210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).