C6H11O3P — CID 13210
4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane (PubChem CID 13210) has the molecular formula C6H11O3P and a molecular weight of 162.12 g/mol. Its IUPAC name is 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane.
| Compound Name | 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 13210 |
| Molecular Formula | C6H11O3P |
| Molecular Weight | 162.12 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 4-ethyl-2,6,7-trioxa-1-phosphabicyclo[2.2.2]octane |
| SMILES | CCC12COP(OC1)OC2 |
| InChI | InChI=1S/C6H11O3P/c1-2-6-3-7-10(8-4-6)9-5-6/h2-5H2,1H3 |
| InChIKey | QRUSNTDXJQBKBI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.12 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|