C8H11NO2 — CID 13211069
1,2,3,4,4a,7a-hexahydrocyclopenta[c]pyridine-5,7-dione (PubChem CID 13211069) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 1,2,3,4,4a,7a-hexahydrocyclopenta[c]pyridine-5,7-dione.
| Compound Name | 1,2,3,4,4a,7a-hexahydrocyclopenta[c]pyridine-5,7-dione |
|---|---|
| PubChem CID | 13211069 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 1,2,3,4,4a,7a-hexahydrocyclopenta[c]pyridine-5,7-dione |
| SMILES | O=C1CC(=O)C2CNCCC12 |
| InChI | InChI=1S/C8H11NO2/c10-7-3-8(11)6-4-9-2-1-5(6)7/h5-6,9H,1-4H2 |
| InChIKey | QWMBVYARERLTHQ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|