C13H15NO — CID 59083233
(4aR,9bS)-7-methyl-1,2,3,4,4a,9b-hexahydroindeno[1,2-c]pyridin-5-one (PubChem CID 59083233) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is (4aR,9bS)-7-methyl-1,2,3,4,4a,9b-hexahydroindeno[1,2-c]pyridin-5-one.
| Compound Name | (4aR,9bS)-7-methyl-1,2,3,4,4a,9b-hexahydroindeno[1,2-c]pyridin-5-one |
|---|---|
| PubChem CID | 59083233 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (4aR,9bS)-7-methyl-1,2,3,4,4a,9b-hexahydroindeno[1,2-c]pyridin-5-one |
| SMILES | Cc1ccc2c(c1)C(=O)[C@@H]1CCNC[C@H]21 |
| InChI | InChI=1S/C13H15NO/c1-8-2-3-9-11(6-8)13(15)10-4-5-14-7-12(9)10/h2-3,6,10,12,14H,4-5,7H2,1H3/t10-,12-/m1/s1 |
| InChIKey | PPDAJGIKKRDMPO-ZYHUDNBSSA-N |
| XLogP | 1.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |