C7H12ClNO — CID 154724409
(3aS,6aR)-2,3,3a,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-one;hydrochloride (PubChem CID 154724409) has the molecular formula C7H12ClNO and a molecular weight of 161.63 g/mol. Its IUPAC name is (3aS,6aR)-2,3,3a,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-one;hydrochloride.
| Compound Name | (3aS,6aR)-2,3,3a,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-one;hydrochloride |
|---|---|
| PubChem CID | 154724409 |
| Molecular Formula | C7H12ClNO |
| Molecular Weight | 161.63 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | (3aS,6aR)-2,3,3a,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-one;hydrochloride |
| SMILES | Cl.O=C1CC[C@H]2CNC[C@@H]12 |
| InChI | InChI=1S/C7H11NO.ClH/c9-7-2-1-5-3-8-4-6(5)7;/h5-6,8H,1-4H2;1H/t5-,6+;/m0./s1 |
| InChIKey | NCJPVPGXNDVUCM-RIHPBJNCSA-N |
| XLogP | 0.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.63 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |