C25H33NO3 — CID 13228204
5,7a-ditert-butyl-3-(2,3,5,6-tetramethylphenyl)-3aH-1,2-benzoxazole-4,7-dione (PubChem CID 13228204) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is 5,7a-ditert-butyl-3-(2,3,5,6-tetramethylphenyl)-3aH-1,2-benzoxazole-4,7-dione.
| Compound Name | 5,7a-ditert-butyl-3-(2,3,5,6-tetramethylphenyl)-3aH-1,2-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 13228204 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | 5,7a-ditert-butyl-3-(2,3,5,6-tetramethylphenyl)-3aH-1,2-benzoxazole-4,7-dione |
| SMILES | Cc1cc(C)c(C)c(C2=NOC3(C(C)(C)C)C(=O)C=C(C(C)(C)C)C(=O)C23)c1C |
| InChI | InChI=1S/C25H33NO3/c1-13-11-14(2)16(4)19(15(13)3)21-20-22(28)17(23(5,6)7)12-18(27)25(20,29-26-21)24(8,9)10/h11-12,20H,1-10H3 |
| InChIKey | HUMSDOPKDGZFGH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |