C17H21N3O2S2 — CID 1323610
1-(2,3-dimethylphenyl)-3-[2-(4-sulfamoylphenyl)ethyl]thiourea (PubChem CID 1323610) has the molecular formula C17H21N3O2S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[2-(4-sulfamoylphenyl)ethyl]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[2-(4-sulfamoylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 1323610 |
| Molecular Formula | C17H21N3O2S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[2-(4-sulfamoylphenyl)ethyl]thiourea |
| SMILES | Cc1cccc(NC(=S)NCCc2ccc(S(N)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C17H21N3O2S2/c1-12-4-3-5-16(13(12)2)20-17(23)19-11-10-14-6-8-15(9-7-14)24(18,21)22/h3-9H,10-11H2,1-2H3,(H2,18,21,22)(H2,19,20,23) |
| InChIKey | ICCWGQPJZADBGK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|