C15H45O10P3Si5 — CID 13249622
bis[bis(trimethylsilyloxy)phosphoryl] trimethylsilyl phosphate (PubChem CID 13249622) has the molecular formula C15H45O10P3Si5 and a molecular weight of 618.87 g/mol. Its IUPAC name is bis[bis(trimethylsilyloxy)phosphoryl] trimethylsilyl phosphate.
| Compound Name | bis[bis(trimethylsilyloxy)phosphoryl] trimethylsilyl phosphate |
|---|---|
| PubChem CID | 13249622 |
| Molecular Formula | C15H45O10P3Si5 |
| Molecular Weight | 618.87 g/mol |
| Exact Mass | 618.11 |
| IUPAC Name | bis[bis(trimethylsilyloxy)phosphoryl] trimethylsilyl phosphate |
| SMILES | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H45O10P3Si5/c1-29(2,3)21-26(16,19-27(17,22-30(4,5)6)23-31(7,8)9)20-28(18,24-32(10,11)12)25-33(13,14)15/h1-15H3 |
| InChIKey | HIBPKTCYTJWWPM-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.87 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|