C13H36F2O6P2Si4 — CID 54308904
[[bis(trimethylsilyloxy)phosphoryl-bis(trimethylsilyl)methyl]-fluorooxyphosphoryl] hypofluorite (PubChem CID 54308904) has the molecular formula C13H36F2O6P2Si4 and a molecular weight of 500.71 g/mol. Its IUPAC name is [[bis(trimethylsilyloxy)phosphoryl-bis(trimethylsilyl)methyl]-fluorooxyphosphoryl] hypofluorite.
| Compound Name | [[bis(trimethylsilyloxy)phosphoryl-bis(trimethylsilyl)methyl]-fluorooxyphosphoryl] hypofluorite |
|---|---|
| PubChem CID | 54308904 |
| Molecular Formula | C13H36F2O6P2Si4 |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | [[bis(trimethylsilyloxy)phosphoryl-bis(trimethylsilyl)methyl]-fluorooxyphosphoryl] hypofluorite |
| SMILES | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)C([Si](C)(C)C)([Si](C)(C)C)P(=O)(OF)OF |
| InChI | InChI=1S/C13H36F2O6P2Si4/c1-24(2,3)13(25(4,5)6,22(16,18-14)19-15)23(17,20-26(7,8)9)21-27(10,11)12/h1-12H3 |
| InChIKey | SJMPHDDTZWXWKR-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|