C22H32O4 — CID 132500382
(6S)-6-methyl-1-[(E)-tridec-11-enyl]-5,6-dihydropyrano[3,4-c]pyran-3,8-dione (PubChem CID 132500382) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (6S)-6-methyl-1-[(E)-tridec-11-enyl]-5,6-dihydropyrano[3,4-c]pyran-3,8-dione.
| Compound Name | (6S)-6-methyl-1-[(E)-tridec-11-enyl]-5,6-dihydropyrano[3,4-c]pyran-3,8-dione |
|---|---|
| PubChem CID | 132500382 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (6S)-6-methyl-1-[(E)-tridec-11-enyl]-5,6-dihydropyrano[3,4-c]pyran-3,8-dione |
| SMILES | C/C=C/CCCCCCCCCCc1oc(=O)cc2c1C(=O)O[C@@H](C)C2 |
| InChI | InChI=1S/C22H32O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-19-21-18(16-20(23)26-19)15-17(2)25-22(21)24/h3-4,16-17H,5-15H2,1-2H3/b4-3+/t17-/m0/s1 |
| InChIKey | GDPLHYVNEPCEPF-IDOMTICXSA-N |
| XLogP | 5.37 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|