C40H23BF10N2 — CID 132500808
N-bis(2,3,4,5,6-pentafluorophenyl)boranyl-N-(4-methylphenyl)-10-(4-methylphenyl)imino-9H-phenanthren-9-amine (PubChem CID 132500808) has the molecular formula C40H23BF10N2 and a molecular weight of 732.43 g/mol. Its IUPAC name is N-bis(2,3,4,5,6-pentafluorophenyl)boranyl-N-(4-methylphenyl)-10-(4-methylphenyl)imino-9H-phenanthren-9-amine.
| Compound Name | N-bis(2,3,4,5,6-pentafluorophenyl)boranyl-N-(4-methylphenyl)-10-(4-methylphenyl)imino-9H-phenanthren-9-amine |
|---|---|
| PubChem CID | 132500808 |
| Molecular Formula | C40H23BF10N2 |
| Molecular Weight | 732.43 g/mol |
| Exact Mass | 732.18 |
| IUPAC Name | N-bis(2,3,4,5,6-pentafluorophenyl)boranyl-N-(4-methylphenyl)-10-(4-methylphenyl)imino-9H-phenanthren-9-amine |
| SMILES | Cc1ccc(/N=C2\c3ccccc3-c3ccccc3C2N(B(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C40H23BF10N2/c1-19-11-15-21(16-12-19)52-39-25-9-5-3-7-23(25)24-8-4-6-10-26(24)40(39)53(22-17-13-20(2)14-18-22)41(27-29(42)33(46)37(50)34(47)30(27)43)28-31(44)35(48)38(51)36(49)32(28)45/h3-18,40H,1-2H3/b52-39+ |
| InChIKey | SBLMJRURAPCNDZ-ADNMOQRASA-N |
| XLogP | 9.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.43 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|