C23H18N4O — CID 10872255
9,10-bis[(4-methylphenyl)imino]-1,8-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-one (PubChem CID 10872255) has the molecular formula C23H18N4O and a molecular weight of 366.42 g/mol. Its IUPAC name is 9,10-bis[(4-methylphenyl)imino]-1,8-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-one.
| Compound Name | 9,10-bis[(4-methylphenyl)imino]-1,8-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-one |
|---|---|
| PubChem CID | 10872255 |
| Molecular Formula | C23H18N4O |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 9,10-bis[(4-methylphenyl)imino]-1,8-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-11-one |
| SMILES | Cc1ccc(/N=C2C(=N\c3ccc(C)cc3)/n3c(=O)n/2c2ccccc23)cc1 |
| InChI | InChI=1S/C23H18N4O/c1-15-7-11-17(12-8-15)24-21-22(25-18-13-9-16(2)10-14-18)27-20-6-4-3-5-19(20)26(21)23(27)28/h3-14H,1-2H3/b24-21-,25-22+ |
| InChIKey | MBIYHNKBVAMQQF-KJQPNGKASA-N |
| XLogP | 4.59 |
| TPSA | 51.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|