C24H13BF10 — CID 122371251
bis(2,3,4,5,6-pentafluorophenyl)-(3-propan-2-yl-1H-inden-1-yl)borane (PubChem CID 122371251) has the molecular formula C24H13BF10 and a molecular weight of 502.16 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-(3-propan-2-yl-1H-inden-1-yl)borane.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-(3-propan-2-yl-1H-inden-1-yl)borane |
|---|---|
| PubChem CID | 122371251 |
| Molecular Formula | C24H13BF10 |
| Molecular Weight | 502.16 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-(3-propan-2-yl-1H-inden-1-yl)borane |
| SMILES | CC(C)C1=CC(B(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c2ccccc21 |
| InChI | InChI=1S/C24H13BF10/c1-8(2)11-7-12(10-6-4-3-5-9(10)11)25(13-15(26)19(30)23(34)20(31)16(13)27)14-17(28)21(32)24(35)22(33)18(14)29/h3-8,12H,1-2H3 |
| InChIKey | QGSZDNDXXFNRMM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.16 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|