C14H18O — CID 134966420
(1S,2S)-2-methyl-4-propan-2-yl-1,2-dihydronaphthalen-1-ol (PubChem CID 134966420) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (1S,2S)-2-methyl-4-propan-2-yl-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1S,2S)-2-methyl-4-propan-2-yl-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 134966420 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (1S,2S)-2-methyl-4-propan-2-yl-1,2-dihydronaphthalen-1-ol |
| SMILES | CC(C)C1=C[C@H](C)[C@H](O)c2ccccc21 |
| InChI | InChI=1S/C14H18O/c1-9(2)13-8-10(3)14(15)12-7-5-4-6-11(12)13/h4-10,14-15H,1-3H3/t10-,14-/m0/s1 |
| InChIKey | LZAMEGYSZMRMRI-HZMBPMFUSA-N |
| XLogP | 3.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |