C12H14O — CID 102230606
(1S,2S)-2,4-dimethyl-1,2-dihydronaphthalen-1-ol (PubChem CID 102230606) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is (1S,2S)-2,4-dimethyl-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1S,2S)-2,4-dimethyl-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 102230606 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (1S,2S)-2,4-dimethyl-1,2-dihydronaphthalen-1-ol |
| SMILES | CC1=C[C@H](C)[C@H](O)c2ccccc21 |
| InChI | InChI=1S/C12H14O/c1-8-7-9(2)12(13)11-6-4-3-5-10(8)11/h3-7,9,12-13H,1-2H3/t9-,12-/m0/s1 |
| InChIKey | OHUQMCFILZQPEQ-CABZTGNLSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |