C50H59N3O2S3 — CID 132503065
16-(2-ethylhexyl)-5,7-bis(3-octylthiophen-2-yl)-6-thia-3,9,16-triazahexacyclo[12.6.2.02,10.04,8.011,21.018,22]docosa-1(21),2,4,7,9,11,13,18(22),19-nonaene-15,17-dione (PubChem CID 132503065) has the molecular formula C50H59N3O2S3 and a molecular weight of 830.24 g/mol. Its IUPAC name is 16-(2-ethylhexyl)-5,7-bis(3-octylthiophen-2-yl)-6-thia-3,9,16-triazahexacyclo[12.6.2.02,10.04,8.011,21.018,22]docosa-1(21),2,4,7,9,11,13,18(22),19-nonaene-15,17-dione.
| Compound Name | 16-(2-ethylhexyl)-5,7-bis(3-octylthiophen-2-yl)-6-thia-3,9,16-triazahexacyclo[12.6.2.02,10.04,8.011,21.018,22]docosa-1(21),2,4,7,9,11,13,18(22),19-nonaene-15,17-dione |
|---|---|
| PubChem CID | 132503065 |
| Molecular Formula | C50H59N3O2S3 |
| Molecular Weight | 830.24 g/mol |
| Exact Mass | 829.38 |
| IUPAC Name | 16-(2-ethylhexyl)-5,7-bis(3-octylthiophen-2-yl)-6-thia-3,9,16-triazahexacyclo[12.6.2.02,10.04,8.011,21.018,22]docosa-1(21),2,4,7,9,11,13,18(22),19-nonaene-15,17-dione |
| SMILES | CCCCCCCCc1ccsc1-c1sc(-c2sccc2CCCCCCCC)c2nc3c(nc12)-c1ccc2c4c(ccc-3c14)C(=O)N(CC(CC)CCCC)C2=O |
| InChI | InChI=1S/C50H59N3O2S3/c1-5-9-12-14-16-18-21-33-27-29-56-45(33)47-43-44(48(58-47)46-34(28-30-57-46)22-19-17-15-13-10-6-2)52-42-36-24-26-38-40-37(25-23-35(39(36)40)41(42)51-43)49(54)53(50(38)55)31-32(8-4)20-11-7-3/h23-30,32H,5-22,31H2,1-4H3 |
| InChIKey | VHOGVNCTLVHDGT-UHFFFAOYSA-N |
| XLogP | 15.57 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.24 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|