C26H12N2O10S2-2 — CID 132504062
4-[5,7,12,14-tetraoxo-13-(4-sulfonatophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]benzenesulfonate (PubChem CID 132504062) has the molecular formula C26H12N2O10S2-2 and a molecular weight of 576.52 g/mol. Its IUPAC name is 4-[5,7,12,14-tetraoxo-13-(4-sulfonatophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]benzenesulfonate.
| Compound Name | 4-[5,7,12,14-tetraoxo-13-(4-sulfonatophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]benzenesulfonate |
|---|---|
| PubChem CID | 132504062 |
| Molecular Formula | C26H12N2O10S2-2 |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 575.99 |
| IUPAC Name | 4-[5,7,12,14-tetraoxo-13-(4-sulfonatophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]benzenesulfonate |
| SMILES | O=C1c2ccc3c4c(ccc(c24)C(=O)N1c1ccc(S(=O)(=O)[O-])cc1)C(=O)N(c1ccc(S(=O)(=O)[O-])cc1)C3=O |
| InChI | InChI=1S/C26H14N2O10S2/c29-23-17-9-11-19-22-20(26(32)28(25(19)31)14-3-7-16(8-4-14)40(36,37)38)12-10-18(21(17)22)24(30)27(23)13-1-5-15(6-2-13)39(33,34)35/h1-12H,(H,33,34,35)(H,36,37,38)/p-2 |
| InChIKey | KXWAXPQHXDKTDW-UHFFFAOYSA-L |
| XLogP | 2.25 |
| TPSA | 189.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|