C22H27ClN2OS — CID 132504333
1-tert-butyl-1-[(2R)-1-(3-chlorophenyl)-1-oxopropan-2-yl]-3-[(1R)-1-phenylethyl]thiourea (PubChem CID 132504333) has the molecular formula C22H27ClN2OS and a molecular weight of 402.99 g/mol. Its IUPAC name is 1-tert-butyl-1-[(2R)-1-(3-chlorophenyl)-1-oxopropan-2-yl]-3-[(1R)-1-phenylethyl]thiourea.
| Compound Name | 1-tert-butyl-1-[(2R)-1-(3-chlorophenyl)-1-oxopropan-2-yl]-3-[(1R)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 132504333 |
| Molecular Formula | C22H27ClN2OS |
| Molecular Weight | 402.99 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-tert-butyl-1-[(2R)-1-(3-chlorophenyl)-1-oxopropan-2-yl]-3-[(1R)-1-phenylethyl]thiourea |
| SMILES | C[C@H](C(=O)c1cccc(Cl)c1)N(C(=S)N[C@H](C)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H27ClN2OS/c1-15(17-10-7-6-8-11-17)24-21(27)25(22(3,4)5)16(2)20(26)18-12-9-13-19(23)14-18/h6-16H,1-5H3,(H,24,27)/t15-,16-/m1/s1 |
| InChIKey | QYGCXPBRENLEIM-HZPDHXFCSA-N |
| XLogP | 5.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.99 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|