C17H17NO6 — CID 132505447
diethyl 4-acetyloxyquinoline-2,3-dicarboxylate (PubChem CID 132505447) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is diethyl 4-acetyloxyquinoline-2,3-dicarboxylate.
| Compound Name | diethyl 4-acetyloxyquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 132505447 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | diethyl 4-acetyloxyquinoline-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1nc2ccccc2c(OC(C)=O)c1C(=O)OCC |
| InChI | InChI=1S/C17H17NO6/c1-4-22-16(20)13-14(17(21)23-5-2)18-12-9-7-6-8-11(12)15(13)24-10(3)19/h6-9H,4-5H2,1-3H3 |
| InChIKey | CHXYMTXTBGADRY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |