C16H12F6NO2+ — CID 132506692
(2,6-dimethylpyridin-1-ium-1-yl) 3,5-bis(trifluoromethyl)benzoate (PubChem CID 132506692) has the molecular formula C16H12F6NO2+ and a molecular weight of 364.27 g/mol. Its IUPAC name is (2,6-dimethylpyridin-1-ium-1-yl) 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | (2,6-dimethylpyridin-1-ium-1-yl) 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 132506692 |
| Molecular Formula | C16H12F6NO2+ |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | (2,6-dimethylpyridin-1-ium-1-yl) 3,5-bis(trifluoromethyl)benzoate |
| SMILES | Cc1cccc(C)[n+]1OC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H12F6NO2/c1-9-4-3-5-10(2)23(9)25-14(24)11-6-12(15(17,18)19)8-13(7-11)16(20,21)22/h3-8H,1-2H3/q+1 |
| InChIKey | IARRYUJAMFLBPH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|