C15H22ClN3S2 — CID 132507022
4-chloro-3-N,3-N,5-N,5-N-tetraethylpyridine-3,5-dicarbothioamide (PubChem CID 132507022) has the molecular formula C15H22ClN3S2 and a molecular weight of 343.95 g/mol. Its IUPAC name is 4-chloro-3-N,3-N,5-N,5-N-tetraethylpyridine-3,5-dicarbothioamide.
| Compound Name | 4-chloro-3-N,3-N,5-N,5-N-tetraethylpyridine-3,5-dicarbothioamide |
|---|---|
| PubChem CID | 132507022 |
| Molecular Formula | C15H22ClN3S2 |
| Molecular Weight | 343.95 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-chloro-3-N,3-N,5-N,5-N-tetraethylpyridine-3,5-dicarbothioamide |
| SMILES | CCN(CC)C(=S)c1cncc(C(=S)N(CC)CC)c1Cl |
| InChI | InChI=1S/C15H22ClN3S2/c1-5-18(6-2)14(20)11-9-17-10-12(13(11)16)15(21)19(7-3)8-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | PKSHWBWNXYKJDZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.95 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|